 Product categoryFriends links |
|
 Click on the image to check the artwork |
|
| product: |
view count: 70Carbazochrome |
| unit price: |
Negotiable |
| min amount: |
|
| amount: |
|
| period for delivery: |
Consignment Deadline days |
| Expiry date: |
Long Effective |
| last update: |
2017-12-03 20:34 |
| |
 |
|
Carbazochrome
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
69-81-8 |
| EC NO: |
200-717-0 |
| Molecular Formula: |
C10H12N4O3
|
| Molecular Weight: |
236.2273 |
| Specification: |
|
| InChI: |
InChI=1/C10H12N4O3/c1-14-4-9(16)5-2-6(12-13-10(11)17)8(15)3-7(5)14/h2-3,9,16H,4H2,1H3,(H3,11,13,17) |
| Synonyms: |
Carbazochrome;adrenochrome monosemicarbazone;(5Z)-3-hydroxy-1-methyl-2,3-dihydro-1H-indole-5,6-dione 5-semicarbazone;3-hydroxy-1-methyl-2,3-dihydro-1H-indole-5,6-dione 5-semicarbazone; |
| Molecular Structure: |
 |
|
